About 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea
3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea (PubChem CID 71836734) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea |
| PubChem CID | 71836734 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)N[C@@H]1CN[C@H](CO)C1 |
| InChI | InChI=1S/C8H17N3O2/c1-11(2)8(13)10-6-3-7(5-12)9-4-6/h6-7,9,12H,3-5H2,1-2H3,(H,10,13)/t6-,7-/m0/s1 |
| InChIKey | MRIJEFMQMXBWPV-BQBZGAKWSA-N |
| XLogP | -1.02 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea?
The IUPAC name of 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea (CID 71836734) is 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea.
What is the SMILES notation for 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea?
The canonical SMILES for 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea is CN(C)C(=O)N[C@@H]1CN[C@H](CO)C1.
What is the InChIKey of 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea?
The InChIKey is MRIJEFMQMXBWPV-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-11(2)8(13)10-6-3-7(5-12)9-4-6/h6-7,9,12H,3-5H2,1-2H3,(H,10,13)/t6-,7-/m0/s1.
What are the key properties of 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea?
3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea has a molecular weight of 187.24 g/mol, XLogP of -1.02, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S,5S)-5-(hydroxymethyl)pyrrolidin-3-yl]-1,1-dimethylurea is sourced from PubChem (CID 71836734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).