C14H18N4O2S — CID 71837237
5-(1-ethylsulfonylpyrrolidin-2-yl)-3-phenyl-1H-1,2,4-triazole (PubChem CID 71837237) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 5-(1-ethylsulfonylpyrrolidin-2-yl)-3-phenyl-1H-1,2,4-triazole.
| Compound Name | 5-(1-ethylsulfonylpyrrolidin-2-yl)-3-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 71837237 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 5-(1-ethylsulfonylpyrrolidin-2-yl)-3-phenyl-1H-1,2,4-triazole |
| SMILES | CCS(=O)(=O)N1CCCC1c1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C14H18N4O2S/c1-2-21(19,20)18-10-6-9-12(18)14-15-13(16-17-14)11-7-4-3-5-8-11/h3-5,7-8,12H,2,6,9-10H2,1H3,(H,15,16,17) |
| InChIKey | LHTBEVQVFKJKRM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |