C13H16N4O2S — CID 71837238
5-(1-methylsulfonylpyrrolidin-2-yl)-3-phenyl-1H-1,2,4-triazole (PubChem CID 71837238) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 5-(1-methylsulfonylpyrrolidin-2-yl)-3-phenyl-1H-1,2,4-triazole.
| Compound Name | 5-(1-methylsulfonylpyrrolidin-2-yl)-3-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 71837238 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 5-(1-methylsulfonylpyrrolidin-2-yl)-3-phenyl-1H-1,2,4-triazole |
| SMILES | CS(=O)(=O)N1CCCC1c1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C13H16N4O2S/c1-20(18,19)17-9-5-8-11(17)13-14-12(15-16-13)10-6-3-2-4-7-10/h2-4,6-7,11H,5,8-9H2,1H3,(H,14,15,16) |
| InChIKey | UJDNVJFQNQAIAT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |