C19H20FN3O4 — CID 71838850
1-(2,4-dimethoxyphenyl)-3-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]urea (PubChem CID 71838850) has the molecular formula C19H20FN3O4 and a molecular weight of 373.38 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 71838850 |
| Molecular Formula | C19H20FN3O4 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]urea |
| SMILES | COc1ccc(NC(=O)NC2CCN(c3ccc(F)cc3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C19H20FN3O4/c1-26-14-7-8-15(17(11-14)27-2)21-19(25)22-16-9-10-23(18(16)24)13-5-3-12(20)4-6-13/h3-8,11,16H,9-10H2,1-2H3,(H2,21,22,25) |
| InChIKey | VPMXLCZQNBBINO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |