C22H23ClN2O4S — CID 71839701
3-(3-chlorophenyl)-1-[7-(4-methylphenyl)sulfonyl-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]prop-2-en-1-one (PubChem CID 71839701) has the molecular formula C22H23ClN2O4S and a molecular weight of 446.96 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[7-(4-methylphenyl)sulfonyl-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]prop-2-en-1-one.
| Compound Name | 3-(3-chlorophenyl)-1-[7-(4-methylphenyl)sulfonyl-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 71839701 |
| Molecular Formula | C22H23ClN2O4S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[7-(4-methylphenyl)sulfonyl-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3CN(C(=O)C=Cc4cccc(Cl)c4)CC(C2)O3)cc1 |
| InChI | InChI=1S/C22H23ClN2O4S/c1-16-5-8-21(9-6-16)30(27,28)25-14-19-12-24(13-20(15-25)29-19)22(26)10-7-17-3-2-4-18(23)11-17/h2-11,19-20H,12-15H2,1H3 |
| InChIKey | WSALJWQWMMLKHB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|