C18H20N4O3S — CID 71840046
N-(3-methoxypropyl)-2-(7-methyl-4-oxo-2-phenyl-[1,3]thiazolo[4,5-d]pyridazin-5-yl)acetamide (PubChem CID 71840046) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(7-methyl-4-oxo-2-phenyl-[1,3]thiazolo[4,5-d]pyridazin-5-yl)acetamide.
| Compound Name | N-(3-methoxypropyl)-2-(7-methyl-4-oxo-2-phenyl-[1,3]thiazolo[4,5-d]pyridazin-5-yl)acetamide |
|---|---|
| PubChem CID | 71840046 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-(3-methoxypropyl)-2-(7-methyl-4-oxo-2-phenyl-[1,3]thiazolo[4,5-d]pyridazin-5-yl)acetamide |
| SMILES | COCCCNC(=O)Cn1nc(C)c2sc(-c3ccccc3)nc2c1=O |
| InChI | InChI=1S/C18H20N4O3S/c1-12-16-15(20-17(26-16)13-7-4-3-5-8-13)18(24)22(21-12)11-14(23)19-9-6-10-25-2/h3-5,7-8H,6,9-11H2,1-2H3,(H,19,23) |
| InChIKey | UQQCHCLKFQVZAC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|