C25H24N4O — CID 71840985
1-[(2-methylphenyl)methyl]-4-pyridin-4-yl-N-(1-pyridin-3-ylethyl)pyrrole-2-carboxamide (PubChem CID 71840985) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]-4-pyridin-4-yl-N-(1-pyridin-3-ylethyl)pyrrole-2-carboxamide.
| Compound Name | 1-[(2-methylphenyl)methyl]-4-pyridin-4-yl-N-(1-pyridin-3-ylethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71840985 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]-4-pyridin-4-yl-N-(1-pyridin-3-ylethyl)pyrrole-2-carboxamide |
| SMILES | Cc1ccccc1Cn1cc(-c2ccncc2)cc1C(=O)NC(C)c1cccnc1 |
| InChI | InChI=1S/C25H24N4O/c1-18-6-3-4-7-22(18)16-29-17-23(20-9-12-26-13-10-20)14-24(29)25(30)28-19(2)21-8-5-11-27-15-21/h3-15,17,19H,16H2,1-2H3,(H,28,30) |
| InChIKey | VTMWXWDDCVRZDK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |