About N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide
N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide (PubChem CID 71842885) has the molecular formula C17H14N4O2
and a molecular weight of 306.32 g/mol. Its IUPAC name is N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide |
| PubChem CID | 71842885 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide |
| SMILES | O=C1CCc2cc(NC(=O)c3n[nH]c4ccccc34)ccc2N1 |
| InChI | InChI=1S/C17H14N4O2/c22-15-8-5-10-9-11(6-7-13(10)19-15)18-17(23)16-12-3-1-2-4-14(12)20-21-16/h1-4,6-7,9H,5,8H2,(H,18,23)(H,19,22)(H,20,21) |
| InChIKey | QCFABHKBPWVNPW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide?
The IUPAC name of N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide (CID 71842885) is N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide.
What is the SMILES notation for N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide?
The canonical SMILES for N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide is O=C1CCc2cc(NC(=O)c3n[nH]c4ccccc34)ccc2N1.
What is the InChIKey of N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide?
The InChIKey is QCFABHKBPWVNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O2/c22-15-8-5-10-9-11(6-7-13(10)19-15)18-17(23)16-12-3-1-2-4-14(12)20-21-16/h1-4,6-7,9H,5,8H2,(H,18,23)(H,19,22)(H,20,21).
What are the key properties of N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide?
N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide has a molecular weight of 306.32 g/mol, XLogP of 2.70, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indazole-3-carboxamide is sourced from PubChem (CID 71842885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).