About N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide
N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 71842953) has the molecular formula C20H19F3N2O3
and a molecular weight of 392.38 g/mol. Its IUPAC name is N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide.
Molecular Properties
| Compound Name | N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide |
| PubChem CID | 71842953 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | CCCN1C(=O)CCc2cc(NC(=O)c3ccc(OC(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C20H19F3N2O3/c1-2-11-25-17-9-6-15(12-14(17)5-10-18(25)26)24-19(27)13-3-7-16(8-4-13)28-20(21,22)23/h3-4,6-9,12H,2,5,10-11H2,1H3,(H,24,27) |
| InChIKey | GHSQDWFAWQIUCE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide?
The IUPAC name of N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide (CID 71842953) is N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide.
What is the SMILES notation for N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide?
The canonical SMILES for N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide is CCCN1C(=O)CCc2cc(NC(=O)c3ccc(OC(F)(F)F)cc3)ccc21.
What is the InChIKey of N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide?
The InChIKey is GHSQDWFAWQIUCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F3N2O3/c1-2-11-25-17-9-6-15(12-14(17)5-10-18(25)26)24-19(27)13-3-7-16(8-4-13)28-20(21,22)23/h3-4,6-9,12H,2,5,10-11H2,1H3,(H,24,27).
What are the key properties of N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide?
N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide has a molecular weight of 392.38 g/mol, XLogP of 4.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-4-(trifluoromethoxy)benzamide is sourced from PubChem (CID 71842953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).