C23H24N4O4S2 — CID 71843413
1-[4-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)thiophen-2-yl]sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 71843413) has the molecular formula C23H24N4O4S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 1-[4-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)thiophen-2-yl]sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[4-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)thiophen-2-yl]sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 71843413 |
| Molecular Formula | C23H24N4O4S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 1-[4-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)thiophen-2-yl]sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)N1CCN(S(=O)(=O)c2cc(-c3noc(C4CCC4)n3)cs2)CC1 |
| InChI | InChI=1S/C23H24N4O4S2/c28-20(10-9-17-5-2-1-3-6-17)26-11-13-27(14-12-26)33(29,30)21-15-19(16-32-21)22-24-23(31-25-22)18-7-4-8-18/h1-3,5-6,9-10,15-16,18H,4,7-8,11-14H2 |
| InChIKey | AALXFURYTHKTTK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|