C20H28N4O3 — CID 71844322
tert-butyl N-[3-[[2-(pyrazol-1-ylmethyl)morpholin-4-yl]methyl]phenyl]carbamate (PubChem CID 71844322) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(pyrazol-1-ylmethyl)morpholin-4-yl]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-(pyrazol-1-ylmethyl)morpholin-4-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 71844322 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | tert-butyl N-[3-[[2-(pyrazol-1-ylmethyl)morpholin-4-yl]methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(CN2CCOC(Cn3cccn3)C2)c1 |
| InChI | InChI=1S/C20H28N4O3/c1-20(2,3)27-19(25)22-17-7-4-6-16(12-17)13-23-10-11-26-18(14-23)15-24-9-5-8-21-24/h4-9,12,18H,10-11,13-15H2,1-3H3,(H,22,25) |
| InChIKey | AZPUUIMTQBYFMS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |