C20H28N4O4S — CID 71844708
1-[[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropylpyrrolidine-3-sulfonamide (PubChem CID 71844708) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is 1-[[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropylpyrrolidine-3-sulfonamide.
| Compound Name | 1-[[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropylpyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 71844708 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-[[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropylpyrrolidine-3-sulfonamide |
| SMILES | CCCCOc1ccc(-c2nnc(CN3CCC(S(=O)(=O)NC4CC4)C3)o2)cc1 |
| InChI | InChI=1S/C20H28N4O4S/c1-2-3-12-27-17-8-4-15(5-9-17)20-22-21-19(28-20)14-24-11-10-18(13-24)29(25,26)23-16-6-7-16/h4-5,8-9,16,18,23H,2-3,6-7,10-14H2,1H3 |
| InChIKey | YQWWZKFDCQPVBA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|