About 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide
2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide (PubChem CID 71846218) has the molecular formula C11H24N2O3S
and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide.
Molecular Properties
| Compound Name | 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide |
| PubChem CID | 71846218 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide |
| SMILES | CC(C)CNC(=O)C(NS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O3S/c1-8(2)7-12-10(14)9(11(3,4)5)13-17(6,15)16/h8-9,13H,7H2,1-6H3,(H,12,14) |
| InChIKey | MLFYIQVTFUDPIP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide?
The IUPAC name of 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide (CID 71846218) is 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide.
What is the SMILES notation for 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide?
The canonical SMILES for 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide is CC(C)CNC(=O)C(NS(C)(=O)=O)C(C)(C)C.
What is the InChIKey of 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide?
The InChIKey is MLFYIQVTFUDPIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O3S/c1-8(2)7-12-10(14)9(11(3,4)5)13-17(6,15)16/h8-9,13H,7H2,1-6H3,(H,12,14).
What are the key properties of 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide?
2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide has a molecular weight of 264.39 g/mol, XLogP of 0.72, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylpropyl)butanamide is sourced from PubChem (CID 71846218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).