C14H14F2N4O3 — CID 71846877
N-(2,4-difluorophenyl)-N'-(5-methoxy-1,3-dimethylpyrazol-4-yl)oxamide (PubChem CID 71846877) has the molecular formula C14H14F2N4O3 and a molecular weight of 324.29 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N'-(5-methoxy-1,3-dimethylpyrazol-4-yl)oxamide.
| Compound Name | N-(2,4-difluorophenyl)-N'-(5-methoxy-1,3-dimethylpyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 71846877 |
| Molecular Formula | C14H14F2N4O3 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-N'-(5-methoxy-1,3-dimethylpyrazol-4-yl)oxamide |
| SMILES | COc1c(NC(=O)C(=O)Nc2ccc(F)cc2F)c(C)nn1C |
| InChI | InChI=1S/C14H14F2N4O3/c1-7-11(14(23-3)20(2)19-7)18-13(22)12(21)17-10-5-4-8(15)6-9(10)16/h4-6H,1-3H3,(H,17,21)(H,18,22) |
| InChIKey | XVIXHJQGXCQSQI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|