About methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate
methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate (PubChem CID 71847434) has the molecular formula C17H22N2O5S
and a molecular weight of 366.44 g/mol. Its IUPAC name is methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate |
| PubChem CID | 71847434 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate |
| SMILES | CCS(=O)(=O)c1ccc2oc(CN3CCCCC3C(=O)OC)nc2c1 |
| InChI | InChI=1S/C17H22N2O5S/c1-3-25(21,22)12-7-8-15-13(10-12)18-16(24-15)11-19-9-5-4-6-14(19)17(20)23-2/h7-8,10,14H,3-6,9,11H2,1-2H3 |
| InChIKey | FISWDUTYEMOTAT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate?
The IUPAC name of methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate (CID 71847434) is methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate.
What is the SMILES notation for methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate?
The canonical SMILES for methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate is CCS(=O)(=O)c1ccc2oc(CN3CCCCC3C(=O)OC)nc2c1.
What is the InChIKey of methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate?
The InChIKey is FISWDUTYEMOTAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O5S/c1-3-25(21,22)12-7-8-15-13(10-12)18-16(24-15)11-19-9-5-4-6-14(19)17(20)23-2/h7-8,10,14H,3-6,9,11H2,1-2H3.
What are the key properties of methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate?
methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate has a molecular weight of 366.44 g/mol, XLogP of 2.15, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]piperidine-2-carboxylate is sourced from PubChem (CID 71847434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).