About N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide
N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide (PubChem CID 71847757) has the molecular formula C14H17F2NO2
and a molecular weight of 269.29 g/mol. Its IUPAC name is N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide.
Molecular Properties
| Compound Name | N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide |
| PubChem CID | 71847757 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide |
| SMILES | O=C(CCc1c(F)cccc1F)N(CCO)C1CC1 |
| InChI | InChI=1S/C14H17F2NO2/c15-12-2-1-3-13(16)11(12)6-7-14(19)17(8-9-18)10-4-5-10/h1-3,10,18H,4-9H2 |
| InChIKey | ZNOPERXLLDKGOK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide?
The IUPAC name of N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide (CID 71847757) is N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide.
What is the SMILES notation for N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide?
The canonical SMILES for N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide is O=C(CCc1c(F)cccc1F)N(CCO)C1CC1.
What is the InChIKey of N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide?
The InChIKey is ZNOPERXLLDKGOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO2/c15-12-2-1-3-13(16)11(12)6-7-14(19)17(8-9-18)10-4-5-10/h1-3,10,18H,4-9H2.
What are the key properties of N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide?
N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide has a molecular weight of 269.29 g/mol, XLogP of 1.88, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-3-(2,6-difluorophenyl)-N-(2-hydroxyethyl)propanamide is sourced from PubChem (CID 71847757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).