C20H33N3O4 — CID 71847965
tert-butyl N-[[1-[2-(4-methoxyphenoxy)ethyl]-4-methylpiperazin-2-yl]methyl]carbamate (PubChem CID 71847965) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl N-[[1-[2-(4-methoxyphenoxy)ethyl]-4-methylpiperazin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[2-(4-methoxyphenoxy)ethyl]-4-methylpiperazin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71847965 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | tert-butyl N-[[1-[2-(4-methoxyphenoxy)ethyl]-4-methylpiperazin-2-yl]methyl]carbamate |
| SMILES | COc1ccc(OCCN2CCN(C)CC2CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H33N3O4/c1-20(2,3)27-19(24)21-14-16-15-22(4)10-11-23(16)12-13-26-18-8-6-17(25-5)7-9-18/h6-9,16H,10-15H2,1-5H3,(H,21,24) |
| InChIKey | VHJBJKVSFIDRIK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |