About N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide
N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide (PubChem CID 71848427) has the molecular formula C14H28N2O3
and a molecular weight of 272.39 g/mol. Its IUPAC name is N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide.
Molecular Properties
| Compound Name | N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide |
| PubChem CID | 71848427 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)NCC(=O)NCC(O)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O3/c1-10(2)6-7-12(18)16-9-13(19)15-8-11(17)14(3,4)5/h10-11,17H,6-9H2,1-5H3,(H,15,19)(H,16,18) |
| InChIKey | ROIVFCDEVMZFNH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide?
The IUPAC name of N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide (CID 71848427) is N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide.
What is the SMILES notation for N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide?
The canonical SMILES for N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide is CC(C)CCC(=O)NCC(=O)NCC(O)C(C)(C)C.
What is the InChIKey of N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide?
The InChIKey is ROIVFCDEVMZFNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O3/c1-10(2)6-7-12(18)16-9-13(19)15-8-11(17)14(3,4)5/h10-11,17H,6-9H2,1-5H3,(H,15,19)(H,16,18).
What are the key properties of N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide?
N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide has a molecular weight of 272.39 g/mol, XLogP of 1.06, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-oxoethyl]-4-methylpentanamide is sourced from PubChem (CID 71848427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).