C15H18Cl2N4O3S — CID 71849411
4-amino-3,5-dichloro-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]benzenesulfonamide (PubChem CID 71849411) has the molecular formula C15H18Cl2N4O3S and a molecular weight of 405.31 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]benzenesulfonamide.
| Compound Name | 4-amino-3,5-dichloro-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71849411 |
| Molecular Formula | C15H18Cl2N4O3S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]benzenesulfonamide |
| SMILES | CCc1n[nH]c(=O)c(CNS(=O)(=O)c2cc(Cl)c(N)c(Cl)c2)c1CC |
| InChI | InChI=1S/C15H18Cl2N4O3S/c1-3-9-10(15(22)21-20-13(9)4-2)7-19-25(23,24)8-5-11(16)14(18)12(17)6-8/h5-6,19H,3-4,7,18H2,1-2H3,(H,21,22) |
| InChIKey | CSSWEOFIUCWCQE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|