About 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine
4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine (PubChem CID 718496) has the molecular formula C15H16N6O
and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine.
Molecular Properties
| Compound Name | 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine |
| PubChem CID | 718496 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine |
| SMILES | c1ccc(Cn2nnc3c(N4CCOCC4)ncnc32)cc1 |
| InChI | InChI=1S/C15H16N6O/c1-2-4-12(5-3-1)10-21-15-13(18-19-21)14(16-11-17-15)20-6-8-22-9-7-20/h1-5,11H,6-10H2 |
| InChIKey | SJWKEXIUOLEKIC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine?
The IUPAC name of 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine (CID 718496) is 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine.
What is the SMILES notation for 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine?
The canonical SMILES for 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine is c1ccc(Cn2nnc3c(N4CCOCC4)ncnc32)cc1.
What is the InChIKey of 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine?
The InChIKey is SJWKEXIUOLEKIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N6O/c1-2-4-12(5-3-1)10-21-15-13(18-19-21)14(16-11-17-15)20-6-8-22-9-7-20/h1-5,11H,6-10H2.
What are the key properties of 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine?
4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine has a molecular weight of 296.33 g/mol, XLogP of 1.11, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)morpholine is sourced from PubChem (CID 718496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).