C16H17IN2O3 — CID 71849880
2-[(6-iodo-3-pyridinyl)oxy]-N-[2-(3-methylphenoxy)ethyl]acetamide (PubChem CID 71849880) has the molecular formula C16H17IN2O3 and a molecular weight of 412.23 g/mol. Its IUPAC name is 2-[(6-iodo-3-pyridinyl)oxy]-N-[2-(3-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-[(6-iodo-3-pyridinyl)oxy]-N-[2-(3-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 71849880 |
| Molecular Formula | C16H17IN2O3 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 2-[(6-iodo-3-pyridinyl)oxy]-N-[2-(3-methylphenoxy)ethyl]acetamide |
| SMILES | Cc1cccc(OCCNC(=O)COc2ccc(I)nc2)c1 |
| InChI | InChI=1S/C16H17IN2O3/c1-12-3-2-4-13(9-12)21-8-7-18-16(20)11-22-14-5-6-15(17)19-10-14/h2-6,9-10H,7-8,11H2,1H3,(H,18,20) |
| InChIKey | YUUFWANBGFXSMO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|