C17H28N4O2 — CID 71850686
2-methyl-1-(4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-one (PubChem CID 71850686) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-methyl-1-(4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-one.
| Compound Name | 2-methyl-1-(4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 71850686 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 2-methyl-1-(4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-one |
| SMILES | Cc1nn(C)c(C)c1CC(C)C(=O)N1CC2OCCN(C)C2C1 |
| InChI | InChI=1S/C17H28N4O2/c1-11(8-14-12(2)18-20(5)13(14)3)17(22)21-9-15-16(10-21)23-7-6-19(15)4/h11,15-16H,6-10H2,1-5H3 |
| InChIKey | VNKFGBHXSURZPN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |