C17H17N5O2S2 — CID 7185121
10-(benzenesulfonyl)-N-butyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine (PubChem CID 7185121) has the molecular formula C17H17N5O2S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 10-(benzenesulfonyl)-N-butyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine.
| Compound Name | 10-(benzenesulfonyl)-N-butyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine |
|---|---|
| PubChem CID | 7185121 |
| Molecular Formula | C17H17N5O2S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 10-(benzenesulfonyl)-N-butyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine |
| SMILES | CCCCNc1nc2c(S(=O)(=O)c3ccccc3)nnn2c2ccsc12 |
| InChI | InChI=1S/C17H17N5O2S2/c1-2-3-10-18-15-14-13(9-11-25-14)22-16(19-15)17(20-21-22)26(23,24)12-7-5-4-6-8-12/h4-9,11H,2-3,10H2,1H3,(H,18,19) |
| InChIKey | KUBPLNHBDKRQHU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|