C17H15N5O2S2 — CID 7185124
10-(benzenesulfonyl)-7-pyrrolidin-1-yl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 7185124) has the molecular formula C17H15N5O2S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 10-(benzenesulfonyl)-7-pyrrolidin-1-yl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 10-(benzenesulfonyl)-7-pyrrolidin-1-yl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 7185124 |
| Molecular Formula | C17H15N5O2S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 10-(benzenesulfonyl)-7-pyrrolidin-1-yl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | O=S(=O)(c1ccccc1)c1nnn2c1nc(N1CCCC1)c1sccc12 |
| InChI | InChI=1S/C17H15N5O2S2/c23-26(24,12-6-2-1-3-7-12)17-16-18-15(21-9-4-5-10-21)14-13(8-11-25-14)22(16)20-19-17/h1-3,6-8,11H,4-5,9-10H2 |
| InChIKey | GCNRQBFIMDIGDC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |