C17H18N4O2S — CID 71851462
2-(4-cyclopropyltriazol-1-yl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 71851462) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(4-cyclopropyltriazol-1-yl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(4-cyclopropyltriazol-1-yl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 71851462 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-(4-cyclopropyltriazol-1-yl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(C2CC2)nn1)N(Cc1ccco1)Cc1cccs1 |
| InChI | InChI=1S/C17H18N4O2S/c22-17(12-21-11-16(18-19-21)13-5-6-13)20(9-14-3-1-7-23-14)10-15-4-2-8-24-15/h1-4,7-8,11,13H,5-6,9-10,12H2 |
| InChIKey | CNMUFUKPXGEUOW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |