About 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole
3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole (PubChem CID 71851464) has the molecular formula C11H14N2O2S
and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole |
| PubChem CID | 71851464 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole |
| SMILES | CCc1cnc(CSCc2cc(C)on2)o1 |
| InChI | InChI=1S/C11H14N2O2S/c1-3-10-5-12-11(14-10)7-16-6-9-4-8(2)15-13-9/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | GFOQDTGYCLDCRO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole?
The IUPAC name of 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole (CID 71851464) is 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole.
What is the SMILES notation for 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole?
The canonical SMILES for 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole is CCc1cnc(CSCc2cc(C)on2)o1.
What is the InChIKey of 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole?
The InChIKey is GFOQDTGYCLDCRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2S/c1-3-10-5-12-11(14-10)7-16-6-9-4-8(2)15-13-9/h4-5H,3,6-7H2,1-2H3.
What are the key properties of 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole?
3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole has a molecular weight of 238.31 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanylmethyl]-5-methyl-1,2-oxazole is sourced from PubChem (CID 71851464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).