C15H19N3O2S — CID 71852030
2-[5-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-1,2,4-oxadiazol-3-yl]-N-methylacetamide (PubChem CID 71852030) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-[5-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-1,2,4-oxadiazol-3-yl]-N-methylacetamide.
| Compound Name | 2-[5-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-1,2,4-oxadiazol-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 71852030 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[5-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-1,2,4-oxadiazol-3-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1noc(-c2cc3c(s2)CCCCCC3)n1 |
| InChI | InChI=1S/C15H19N3O2S/c1-16-14(19)9-13-17-15(20-18-13)12-8-10-6-4-2-3-5-7-11(10)21-12/h8H,2-7,9H2,1H3,(H,16,19) |
| InChIKey | RDEBWMDKXVGGSE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |