About N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine
N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine (PubChem CID 71852156) has the molecular formula C18H19N5O2
and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine.
Molecular Properties
| Compound Name | N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine |
| PubChem CID | 71852156 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine |
| SMILES | Cc1cc(C)n(-c2ccc(C(C)Nc3ccc([N+](=O)[O-])cn3)cc2)n1 |
| InChI | InChI=1S/C18H19N5O2/c1-12-10-13(2)22(21-12)16-6-4-15(5-7-16)14(3)20-18-9-8-17(11-19-18)23(24)25/h4-11,14H,1-3H3,(H,19,20) |
| InChIKey | UDIFWQWNEIUSEB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine?
The IUPAC name of N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine (CID 71852156) is N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine.
What is the SMILES notation for N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine?
The canonical SMILES for N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine is Cc1cc(C)n(-c2ccc(C(C)Nc3ccc([N+](=O)[O-])cn3)cc2)n1.
What is the InChIKey of N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine?
The InChIKey is UDIFWQWNEIUSEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N5O2/c1-12-10-13(2)22(21-12)16-6-4-15(5-7-16)14(3)20-18-9-8-17(11-19-18)23(24)25/h4-11,14H,1-3H3,(H,19,20).
What are the key properties of N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine?
N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine has a molecular weight of 337.38 g/mol, XLogP of 3.97, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-nitropyridin-2-amine is sourced from PubChem (CID 71852156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).