C19H21F3N4O — CID 71853326
N-(2-anilinoethyl)-2-methyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline-6-carboxamide (PubChem CID 71853326) has the molecular formula C19H21F3N4O and a molecular weight of 378.40 g/mol. Its IUPAC name is N-(2-anilinoethyl)-2-methyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline-6-carboxamide.
| Compound Name | N-(2-anilinoethyl)-2-methyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
|---|---|
| PubChem CID | 71853326 |
| Molecular Formula | C19H21F3N4O |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-(2-anilinoethyl)-2-methyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
| SMILES | Cc1nc2c(c(C(F)(F)F)n1)CC(C(=O)NCCNc1ccccc1)CC2 |
| InChI | InChI=1S/C19H21F3N4O/c1-12-25-16-8-7-13(11-15(16)17(26-12)19(20,21)22)18(27)24-10-9-23-14-5-3-2-4-6-14/h2-6,13,23H,7-11H2,1H3,(H,24,27) |
| InChIKey | UYZMGIDKNCNAOD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|