C22H28ClN3O3 — CID 71853509
[1-(3-chloro-4-methylphenyl)-5-cyclopropylpyrazol-4-yl]-[4-(3-hydroxypropoxy)piperidin-1-yl]methanone (PubChem CID 71853509) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is [1-(3-chloro-4-methylphenyl)-5-cyclopropylpyrazol-4-yl]-[4-(3-hydroxypropoxy)piperidin-1-yl]methanone.
| Compound Name | [1-(3-chloro-4-methylphenyl)-5-cyclopropylpyrazol-4-yl]-[4-(3-hydroxypropoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 71853509 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [1-(3-chloro-4-methylphenyl)-5-cyclopropylpyrazol-4-yl]-[4-(3-hydroxypropoxy)piperidin-1-yl]methanone |
| SMILES | Cc1ccc(-n2ncc(C(=O)N3CCC(OCCCO)CC3)c2C2CC2)cc1Cl |
| InChI | InChI=1S/C22H28ClN3O3/c1-15-3-6-17(13-20(15)23)26-21(16-4-5-16)19(14-24-26)22(28)25-9-7-18(8-10-25)29-12-2-11-27/h3,6,13-14,16,18,27H,2,4-5,7-12H2,1H3 |
| InChIKey | ZTABUQVNMSGRFI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|