C15H14F3N3O — CID 71853620
2-cyclopropyl-1-[[3-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxamide (PubChem CID 71853620) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-cyclopropyl-1-[[3-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxamide.
| Compound Name | 2-cyclopropyl-1-[[3-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 71853620 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-cyclopropyl-1-[[3-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxamide |
| SMILES | NC(=O)c1cn(Cc2cccc(C(F)(F)F)c2)c(C2CC2)n1 |
| InChI | InChI=1S/C15H14F3N3O/c16-15(17,18)11-3-1-2-9(6-11)7-21-8-12(13(19)22)20-14(21)10-4-5-10/h1-3,6,8,10H,4-5,7H2,(H2,19,22) |
| InChIKey | PPGAJFHWUXMYGN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |