C16H21ClN4O4S — CID 71854121
N-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-2-(2-ethoxyethylsulfonylamino)acetamide (PubChem CID 71854121) has the molecular formula C16H21ClN4O4S and a molecular weight of 400.89 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-2-(2-ethoxyethylsulfonylamino)acetamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-2-(2-ethoxyethylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 71854121 |
| Molecular Formula | C16H21ClN4O4S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-2-(2-ethoxyethylsulfonylamino)acetamide |
| SMILES | CCOCCS(=O)(=O)NCC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H21ClN4O4S/c1-2-25-7-8-26(23,24)19-10-16(22)20-15-9-18-21(12-15)11-13-3-5-14(17)6-4-13/h3-6,9,12,19H,2,7-8,10-11H2,1H3,(H,20,22) |
| InChIKey | QCQXAZQMBLCADN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|