About 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile
5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile (PubChem CID 71854450) has the molecular formula C9H13N3S2
and a molecular weight of 227.36 g/mol. Its IUPAC name is 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile.
Molecular Properties
| Compound Name | 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile |
| PubChem CID | 71854450 |
| Molecular Formula | C9H13N3S2 |
| Molecular Weight | 227.36 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile |
| SMILES | CCc1nsc(SCCCCC#N)n1 |
| InChI | InChI=1S/C9H13N3S2/c1-2-8-11-9(14-12-8)13-7-5-3-4-6-10/h2-5,7H2,1H3 |
| InChIKey | HYABHVAOVLPFTE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile?
The IUPAC name of 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile (CID 71854450) is 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile.
What is the SMILES notation for 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile?
The canonical SMILES for 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile is CCc1nsc(SCCCCC#N)n1.
What is the InChIKey of 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile?
The InChIKey is HYABHVAOVLPFTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3S2/c1-2-8-11-9(14-12-8)13-7-5-3-4-6-10/h2-5,7H2,1H3.
What are the key properties of 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile?
5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile has a molecular weight of 227.36 g/mol, XLogP of 2.89, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile is sourced from PubChem (CID 71854450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).