C19H20N4O2S — CID 71854653
N'-(1-benzylpyrazol-4-yl)-N-[(5-ethylthiophen-2-yl)methyl]oxamide (PubChem CID 71854653) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is N'-(1-benzylpyrazol-4-yl)-N-[(5-ethylthiophen-2-yl)methyl]oxamide.
| Compound Name | N'-(1-benzylpyrazol-4-yl)-N-[(5-ethylthiophen-2-yl)methyl]oxamide |
|---|---|
| PubChem CID | 71854653 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N'-(1-benzylpyrazol-4-yl)-N-[(5-ethylthiophen-2-yl)methyl]oxamide |
| SMILES | CCc1ccc(CNC(=O)C(=O)Nc2cnn(Cc3ccccc3)c2)s1 |
| InChI | InChI=1S/C19H20N4O2S/c1-2-16-8-9-17(26-16)11-20-18(24)19(25)22-15-10-21-23(13-15)12-14-6-4-3-5-7-14/h3-10,13H,2,11-12H2,1H3,(H,20,24)(H,22,25) |
| InChIKey | OXTULKIJONWJKM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|