About N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide
N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide (PubChem CID 71854780) has the molecular formula C11H9F3N4O2
and a molecular weight of 286.21 g/mol. Its IUPAC name is N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide |
| PubChem CID | 71854780 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cccn(CC(F)(F)F)c1=O)c1ccn[nH]1 |
| InChI | InChI=1S/C11H9F3N4O2/c12-11(13,14)6-18-5-1-2-8(10(18)20)16-9(19)7-3-4-15-17-7/h1-5H,6H2,(H,15,17)(H,16,19) |
| InChIKey | DYFNCYZLTXZZDE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide?
The IUPAC name of N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide (CID 71854780) is N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide.
What is the SMILES notation for N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide?
The canonical SMILES for N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide is O=C(Nc1cccn(CC(F)(F)F)c1=O)c1ccn[nH]1.
What is the InChIKey of N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide?
The InChIKey is DYFNCYZLTXZZDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N4O2/c12-11(13,14)6-18-5-1-2-8(10(18)20)16-9(19)7-3-4-15-17-7/h1-5H,6H2,(H,15,17)(H,16,19).
What are the key properties of N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide?
N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide has a molecular weight of 286.21 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 71854780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).