About 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea
1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea (PubChem CID 71855707) has the molecular formula C16H17N5O2S
and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea |
| PubChem CID | 71855707 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea |
| SMILES | COc1c(NC(=O)Nc2ncc(-c3ccccc3)s2)c(C)nn1C |
| InChI | InChI=1S/C16H17N5O2S/c1-10-13(14(23-3)21(2)20-10)18-15(22)19-16-17-9-12(24-16)11-7-5-4-6-8-11/h4-9H,1-3H3,(H2,17,18,19,22) |
| InChIKey | KSOWXBNRLIIWBS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea (CID 71855707) is 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea is COc1c(NC(=O)Nc2ncc(-c3ccccc3)s2)c(C)nn1C.
What is the InChIKey of 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea?
The InChIKey is KSOWXBNRLIIWBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O2S/c1-10-13(14(23-3)21(2)20-10)18-15(22)19-16-17-9-12(24-16)11-7-5-4-6-8-11/h4-9H,1-3H3,(H2,17,18,19,22).
What are the key properties of 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea?
1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea has a molecular weight of 343.41 g/mol, XLogP of 3.50, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methoxy-1,3-dimethylpyrazol-4-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 71855707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).