About methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate
methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate (PubChem CID 71855792) has the molecular formula C13H19N3O2S
and a molecular weight of 281.38 g/mol. Its IUPAC name is methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate |
| PubChem CID | 71855792 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate |
| SMILES | COC(=O)CN(CC#N)Cc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C13H19N3O2S/c1-13(2,3)10-9-19-11(15-10)7-16(6-5-14)8-12(17)18-4/h9H,6-8H2,1-4H3 |
| InChIKey | BNVWAPLTKMTLCJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate?
The IUPAC name of methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate (CID 71855792) is methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate.
What is the SMILES notation for methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate?
The canonical SMILES for methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate is COC(=O)CN(CC#N)Cc1nc(C(C)(C)C)cs1.
What is the InChIKey of methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate?
The InChIKey is BNVWAPLTKMTLCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2S/c1-13(2,3)10-9-19-11(15-10)7-16(6-5-14)8-12(17)18-4/h9H,6-8H2,1-4H3.
What are the key properties of methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate?
methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate has a molecular weight of 281.38 g/mol, XLogP of 1.94, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl-(cyanomethyl)amino]acetate is sourced from PubChem (CID 71855792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).