C16H22N2O3 — CID 71855809
1-[(5-ethoxy-2-pyridinyl)methyl]-3,3-diethylpyrrolidine-2,5-dione (PubChem CID 71855809) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-[(5-ethoxy-2-pyridinyl)methyl]-3,3-diethylpyrrolidine-2,5-dione.
| Compound Name | 1-[(5-ethoxy-2-pyridinyl)methyl]-3,3-diethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 71855809 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-[(5-ethoxy-2-pyridinyl)methyl]-3,3-diethylpyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(CN2C(=O)CC(CC)(CC)C2=O)nc1 |
| InChI | InChI=1S/C16H22N2O3/c1-4-16(5-2)9-14(19)18(15(16)20)11-12-7-8-13(10-17-12)21-6-3/h7-8,10H,4-6,9,11H2,1-3H3 |
| InChIKey | QGSHLUKZIYQVPD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|