C17H21N3O7S2 — CID 71856391
5-[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]-2-methylfuran-3-sulfonamide (PubChem CID 71856391) has the molecular formula C17H21N3O7S2 and a molecular weight of 443.50 g/mol. Its IUPAC name is 5-[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]-2-methylfuran-3-sulfonamide.
| Compound Name | 5-[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]-2-methylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 71856391 |
| Molecular Formula | C17H21N3O7S2 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 5-[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]-2-methylfuran-3-sulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)c3cc(S(N)(=O)=O)c(C)o3)CC2)cc1 |
| InChI | InChI=1S/C17H21N3O7S2/c1-12-16(28(18,22)23)11-15(27-12)17(21)19-7-9-20(10-8-19)29(24,25)14-5-3-13(26-2)4-6-14/h3-6,11H,7-10H2,1-2H3,(H2,18,22,23) |
| InChIKey | HBFWUMQINGDQEI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |