About N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide
N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide (PubChem CID 71856428) has the molecular formula C16H20N4O2S
and a molecular weight of 332.43 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide.
Molecular Properties
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide |
| PubChem CID | 71856428 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide |
| SMILES | CN(C)CCN(Cc1ccco1)C(=O)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C16H20N4O2S/c1-18(2)5-6-19(12-14-4-3-8-22-14)15(21)10-13-11-20-7-9-23-16(20)17-13/h3-4,7-9,11H,5-6,10,12H2,1-2H3 |
| InChIKey | IJRVTVASZYEVRY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide?
The IUPAC name of N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide (CID 71856428) is N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide.
What is the SMILES notation for N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide?
The canonical SMILES for N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide is CN(C)CCN(Cc1ccco1)C(=O)Cc1cn2ccsc2n1.
What is the InChIKey of N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide?
The InChIKey is IJRVTVASZYEVRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O2S/c1-18(2)5-6-19(12-14-4-3-8-22-14)15(21)10-13-11-20-7-9-23-16(20)17-13/h3-4,7-9,11H,5-6,10,12H2,1-2H3.
What are the key properties of N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide?
N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide has a molecular weight of 332.43 g/mol, XLogP of 2.12, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)ethyl]-N-(furan-2-ylmethyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide is sourced from PubChem (CID 71856428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).