About (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone
(2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone (PubChem CID 71856535) has the molecular formula C12H17NO2S2
and a molecular weight of 271.41 g/mol. Its IUPAC name is (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone.
Molecular Properties
| Compound Name | (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone |
| PubChem CID | 71856535 |
| Molecular Formula | C12H17NO2S2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccsc1C(=O)N1CCS(=O)C(C)(C)C1 |
| InChI | InChI=1S/C12H17NO2S2/c1-9-4-6-16-10(9)11(14)13-5-7-17(15)12(2,3)8-13/h4,6H,5,7-8H2,1-3H3 |
| InChIKey | CQOPIAVKKHHNLV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone?
The IUPAC name of (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone (CID 71856535) is (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone.
What is the SMILES notation for (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone?
The canonical SMILES for (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone is Cc1ccsc1C(=O)N1CCS(=O)C(C)(C)C1.
What is the InChIKey of (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone?
The InChIKey is CQOPIAVKKHHNLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2S2/c1-9-4-6-16-10(9)11(14)13-5-7-17(15)12(2,3)8-13/h4,6H,5,7-8H2,1-3H3.
What are the key properties of (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone?
(2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone has a molecular weight of 271.41 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(3-methylthiophen-2-yl)methanone is sourced from PubChem (CID 71856535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).