About N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide
N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide (PubChem CID 71856753) has the molecular formula C10H18N2O2S
and a molecular weight of 230.33 g/mol. Its IUPAC name is N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide |
| PubChem CID | 71856753 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide |
| SMILES | CCCC1SCCN1C(=O)CNC(C)=O |
| InChI | InChI=1S/C10H18N2O2S/c1-3-4-10-12(5-6-15-10)9(14)7-11-8(2)13/h10H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | OXNYFWDWTFWZLX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide?
The IUPAC name of N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide (CID 71856753) is N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide?
The canonical SMILES for N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide is CCCC1SCCN1C(=O)CNC(C)=O.
What is the InChIKey of N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide?
The InChIKey is OXNYFWDWTFWZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2S/c1-3-4-10-12(5-6-15-10)9(14)7-11-8(2)13/h10H,3-7H2,1-2H3,(H,11,13).
What are the key properties of N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide?
N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide has a molecular weight of 230.33 g/mol, XLogP of 0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-oxo-2-(2-propyl-1,3-thiazolidin-3-yl)ethyl]acetamide is sourced from PubChem (CID 71856753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).