About cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate
cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate (PubChem CID 71856991) has the molecular formula C15H23NO3
and a molecular weight of 265.35 g/mol. Its IUPAC name is cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate.
Molecular Properties
| Compound Name | cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate |
| PubChem CID | 71856991 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate |
| SMILES | CCc1noc(CC)c1CC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C15H23NO3/c1-3-13-12(14(4-2)19-16-13)10-15(17)18-11-8-6-5-7-9-11/h11H,3-10H2,1-2H3 |
| InChIKey | GPNLEVHITLHNRG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate?
The IUPAC name of cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate (CID 71856991) is cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate.
What is the SMILES notation for cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate?
The canonical SMILES for cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate is CCc1noc(CC)c1CC(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate?
The InChIKey is GPNLEVHITLHNRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-3-13-12(14(4-2)19-16-13)10-15(17)18-11-8-6-5-7-9-11/h11H,3-10H2,1-2H3.
What are the key properties of cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate?
cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate has a molecular weight of 265.35 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-(3,5-diethyl-1,2-oxazol-4-yl)acetate is sourced from PubChem (CID 71856991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).