About 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide
4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide (PubChem CID 71857143) has the molecular formula C17H30N2O3
and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide |
| PubChem CID | 71857143 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide |
| SMILES | CCC(CC)NC(=O)C1CC(=O)CC1C(=O)NC(CC)CC |
| InChI | InChI=1S/C17H30N2O3/c1-5-11(6-2)18-16(21)14-9-13(20)10-15(14)17(22)19-12(7-3)8-4/h11-12,14-15H,5-10H2,1-4H3,(H,18,21)(H,19,22) |
| InChIKey | XNSZALWGGPPYFC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide?
The IUPAC name of 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide (CID 71857143) is 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide.
What is the SMILES notation for 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide?
The canonical SMILES for 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide is CCC(CC)NC(=O)C1CC(=O)CC1C(=O)NC(CC)CC.
What is the InChIKey of 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide?
The InChIKey is XNSZALWGGPPYFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O3/c1-5-11(6-2)18-16(21)14-9-13(20)10-15(14)17(22)19-12(7-3)8-4/h11-12,14-15H,5-10H2,1-4H3,(H,18,21)(H,19,22).
What are the key properties of 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide?
4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide has a molecular weight of 310.44 g/mol, XLogP of 2.19, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-1-N,2-N-di(pentan-3-yl)cyclopentane-1,2-dicarboxamide is sourced from PubChem (CID 71857143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).