C19H25N5O — CID 71857252
1-(2-cyanoethyl)-1-[3-(dimethylamino)propyl]-3-(2-methylquinolin-8-yl)urea (PubChem CID 71857252) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-1-[3-(dimethylamino)propyl]-3-(2-methylquinolin-8-yl)urea.
| Compound Name | 1-(2-cyanoethyl)-1-[3-(dimethylamino)propyl]-3-(2-methylquinolin-8-yl)urea |
|---|---|
| PubChem CID | 71857252 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 1-(2-cyanoethyl)-1-[3-(dimethylamino)propyl]-3-(2-methylquinolin-8-yl)urea |
| SMILES | Cc1ccc2cccc(NC(=O)N(CCC#N)CCCN(C)C)c2n1 |
| InChI | InChI=1S/C19H25N5O/c1-15-9-10-16-7-4-8-17(18(16)21-15)22-19(25)24(13-5-11-20)14-6-12-23(2)3/h4,7-10H,5-6,12-14H2,1-3H3,(H,22,25) |
| InChIKey | YMPQHAQQGAJZMR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |