C20H15FN4O3S — CID 71857459
6-(4-fluorophenoxy)-N'-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methoxy]pyridine-3-carboximidamide (PubChem CID 71857459) has the molecular formula C20H15FN4O3S and a molecular weight of 410.43 g/mol. Its IUPAC name is 6-(4-fluorophenoxy)-N'-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methoxy]pyridine-3-carboximidamide.
| Compound Name | 6-(4-fluorophenoxy)-N'-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methoxy]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 71857459 |
| Molecular Formula | C20H15FN4O3S |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 6-(4-fluorophenoxy)-N'-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methoxy]pyridine-3-carboximidamide |
| SMILES | N/C(=N/OCc1ncc(-c2cccs2)o1)c1ccc(Oc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C20H15FN4O3S/c21-14-4-6-15(7-5-14)27-18-8-3-13(10-23-18)20(22)25-26-12-19-24-11-16(28-19)17-2-1-9-29-17/h1-11H,12H2,(H2,22,25) |
| InChIKey | MEBQLBNDOADULM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|