C18H22N2O4 — CID 71857943
N-(furan-2-ylmethyl)-N-[(4-hydroxyphenyl)methyl]-4-methylmorpholine-2-carboxamide (PubChem CID 71857943) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[(4-hydroxyphenyl)methyl]-4-methylmorpholine-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[(4-hydroxyphenyl)methyl]-4-methylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 71857943 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[(4-hydroxyphenyl)methyl]-4-methylmorpholine-2-carboxamide |
| SMILES | CN1CCOC(C(=O)N(Cc2ccc(O)cc2)Cc2ccco2)C1 |
| InChI | InChI=1S/C18H22N2O4/c1-19-8-10-24-17(13-19)18(22)20(12-16-3-2-9-23-16)11-14-4-6-15(21)7-5-14/h2-7,9,17,21H,8,10-13H2,1H3 |
| InChIKey | GATMHYYWGWVXAW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |