C14H18FNO2 — CID 71857988
3-(2-fluorophenyl)-1-[(3S)-3-hydroxypyrrolidin-1-yl]-2-methylpropan-1-one (PubChem CID 71857988) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-[(3S)-3-hydroxypyrrolidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 3-(2-fluorophenyl)-1-[(3S)-3-hydroxypyrrolidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 71857988 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-(2-fluorophenyl)-1-[(3S)-3-hydroxypyrrolidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(Cc1ccccc1F)C(=O)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C14H18FNO2/c1-10(8-11-4-2-3-5-13(11)15)14(18)16-7-6-12(17)9-16/h2-5,10,12,17H,6-9H2,1H3/t10?,12-/m0/s1 |
| InChIKey | HGXYUMPZZFPTRM-KFJBMODSSA-N |
| XLogP | 1.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |