C16H12ClN3O2 — CID 7185897
2-chloro-N-[(4-oxo-3H-phthalazin-1-yl)methyl]benzamide (PubChem CID 7185897) has the molecular formula C16H12ClN3O2 and a molecular weight of 313.74 g/mol. Its IUPAC name is 2-chloro-N-[(4-oxo-3H-phthalazin-1-yl)methyl]benzamide.
| Compound Name | 2-chloro-N-[(4-oxo-3H-phthalazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 7185897 |
| Molecular Formula | C16H12ClN3O2 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2-chloro-N-[(4-oxo-3H-phthalazin-1-yl)methyl]benzamide |
| SMILES | O=C(NCc1n[nH]c(=O)c2ccccc12)c1ccccc1Cl |
| InChI | InChI=1S/C16H12ClN3O2/c17-13-8-4-3-7-12(13)15(21)18-9-14-10-5-1-2-6-11(10)16(22)20-19-14/h1-8H,9H2,(H,18,21)(H,20,22) |
| InChIKey | NTLZFGUZGRJMKX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |