About [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone
[1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 71859453) has the molecular formula C19H26N4O2
and a molecular weight of 342.44 g/mol. Its IUPAC name is [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone |
| PubChem CID | 71859453 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1ccc2nc(CN3CCCCC3C(=O)N3CCOCC3)cn2c1 |
| InChI | InChI=1S/C19H26N4O2/c1-15-5-6-18-20-16(14-23(18)12-15)13-22-7-3-2-4-17(22)19(24)21-8-10-25-11-9-21/h5-6,12,14,17H,2-4,7-11,13H2,1H3 |
| InChIKey | OTFQWLNTIHOVLH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone?
The IUPAC name of [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone (CID 71859453) is [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone is Cc1ccc2nc(CN3CCCCC3C(=O)N3CCOCC3)cn2c1.
What is the InChIKey of [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone?
The InChIKey is OTFQWLNTIHOVLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O2/c1-15-5-6-18-20-16(14-23(18)12-15)13-22-7-3-2-4-17(22)19(24)21-8-10-25-11-9-21/h5-6,12,14,17H,2-4,7-11,13H2,1H3.
What are the key properties of [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone?
[1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone has a molecular weight of 342.44 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 71859453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).